C13H21N3O4S2 — CID 119963222
3-(1,4-diazepan-1-ylsulfonyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 119963222) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-ylsulfonyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-(1,4-diazepan-1-ylsulfonyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 119963222 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-(1,4-diazepan-1-ylsulfonyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(S(=O)(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-15(2)21(17,18)12-5-3-6-13(11-12)22(19,20)16-9-4-7-14-8-10-16/h3,5-6,11,14H,4,7-10H2,1-2H3 |
| InChIKey | DOTAYZGKAJSVHT-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |