C13H21ClN2O3S — CID 120999396
1-(3-ethoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 120999396) has the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride.
| Compound Name | 1-(3-ethoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 120999396 |
| Molecular Formula | C13H21ClN2O3S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(3-ethoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | CCOc1cccc(S(=O)(=O)N2CCCNCC2)c1.Cl |
| InChI | InChI=1S/C13H20N2O3S.ClH/c1-2-18-12-5-3-6-13(11-12)19(16,17)15-9-4-7-14-8-10-15;/h3,5-6,11,14H,2,4,7-10H2,1H3;1H |
| InChIKey | UCOBEOLSFSNQJN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |