C16H27ClN2O3S — CID 119963409
1-(4-pentoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 119963409) has the molecular formula C16H27ClN2O3S and a molecular weight of 362.92 g/mol. Its IUPAC name is 1-(4-pentoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride.
| Compound Name | 1-(4-pentoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963409 |
| Molecular Formula | C16H27ClN2O3S |
| Molecular Weight | 362.92 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-(4-pentoxyphenyl)sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | CCCCCOc1ccc(S(=O)(=O)N2CCCNCC2)cc1.Cl |
| InChI | InChI=1S/C16H26N2O3S.ClH/c1-2-3-4-14-21-15-6-8-16(9-7-15)22(19,20)18-12-5-10-17-11-13-18;/h6-9,17H,2-5,10-14H2,1H3;1H |
| InChIKey | SKIWOZUJKPVQPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|