C15H24N2O4S — CID 119963333
1-(3,4-diethoxyphenyl)sulfonyl-1,4-diazepane (PubChem CID 119963333) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(3,4-diethoxyphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 119963333 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)sulfonyl-1,4-diazepane |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCNCC2)cc1OCC |
| InChI | InChI=1S/C15H24N2O4S/c1-3-20-14-7-6-13(12-15(14)21-4-2)22(18,19)17-10-5-8-16-9-11-17/h6-7,12,16H,3-5,8-11H2,1-2H3 |
| InChIKey | CVKMBDOHGDIXAZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |