C20H25ClN2O4S — CID 9030930
1-(2-chlorophenyl)-4-(3,4-diethoxyphenyl)sulfonylpiperazine (PubChem CID 9030930) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-(3,4-diethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(2-chlorophenyl)-4-(3,4-diethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 9030930 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-(2-chlorophenyl)-4-(3,4-diethoxyphenyl)sulfonylpiperazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(c3ccccc3Cl)CC2)cc1OCC |
| InChI | InChI=1S/C20H25ClN2O4S/c1-3-26-19-10-9-16(15-20(19)27-4-2)28(24,25)23-13-11-22(12-14-23)18-8-6-5-7-17(18)21/h5-10,15H,3-4,11-14H2,1-2H3 |
| InChIKey | AXVYXTFWYDJNMN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |