C16H26N2O6S2 — CID 24678943
N-[1-(3,4-diethoxyphenyl)sulfonylpiperidin-4-yl]methanesulfonamide (PubChem CID 24678943) has the molecular formula C16H26N2O6S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)sulfonylpiperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)sulfonylpiperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 24678943 |
| Molecular Formula | C16H26N2O6S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)sulfonylpiperidin-4-yl]methanesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(NS(C)(=O)=O)CC2)cc1OCC |
| InChI | InChI=1S/C16H26N2O6S2/c1-4-23-15-7-6-14(12-16(15)24-5-2)26(21,22)18-10-8-13(9-11-18)17-25(3,19)20/h6-7,12-13,17H,4-5,8-11H2,1-3H3 |
| InChIKey | HEVJIIBQQKDSRH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |