C17H27N3O5S — CID 9190138
2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide (PubChem CID 9190138) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 9190138 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]-N-methylacetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(CC(=O)NC)CC2)cc1OCC |
| InChI | InChI=1S/C17H27N3O5S/c1-4-24-15-7-6-14(12-16(15)25-5-2)26(22,23)20-10-8-19(9-11-20)13-17(21)18-3/h6-7,12H,4-5,8-11,13H2,1-3H3,(H,18,21) |
| InChIKey | GVKPELHIQSNQFD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |