C19H29N3O5S — CID 9189839
N-cyclopropyl-2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 9189839) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9189839 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-cyclopropyl-2-[4-(3,4-diethoxyphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(CC(=O)NC3CC3)CC2)cc1OCC |
| InChI | InChI=1S/C19H29N3O5S/c1-3-26-17-8-7-16(13-18(17)27-4-2)28(24,25)22-11-9-21(10-12-22)14-19(23)20-15-5-6-15/h7-8,13,15H,3-6,9-12,14H2,1-2H3,(H,20,23) |
| InChIKey | GQDFFORIDWURER-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |