C15H20FN3O3S — CID 27664766
N-cyclopropyl-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 27664766) has the molecular formula C15H20FN3O3S and a molecular weight of 341.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27664766 |
| Molecular Formula | C15H20FN3O3S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-cyclopropyl-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccc(F)c2)CC1)NC1CC1 |
| InChI | InChI=1S/C15H20FN3O3S/c16-12-2-1-3-14(10-12)23(21,22)19-8-6-18(7-9-19)11-15(20)17-13-4-5-13/h1-3,10,13H,4-9,11H2,(H,17,20) |
| InChIKey | MXOLWMWRHOGZGO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |