C18H23ClN2O4S — CID 119963371
1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 119963371) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,4-diazepane;hydrochloride.
| Compound Name | 1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963371 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[4-(4-methoxyphenoxy)phenyl]sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)N3CCCNCC3)cc2)cc1.Cl |
| InChI | InChI=1S/C18H22N2O4S.ClH/c1-23-15-3-5-16(6-4-15)24-17-7-9-18(10-8-17)25(21,22)20-13-2-11-19-12-14-20;/h3-10,19H,2,11-14H2,1H3;1H |
| InChIKey | UGABNVRWDPOJFW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |