C17H20N2O2S — CID 119963549
1-(4-phenylphenyl)sulfonyl-1,4-diazepane (PubChem CID 119963549) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-(4-phenylphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(4-phenylphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 119963549 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-(4-phenylphenyl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc(-c2ccccc2)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C17H20N2O2S/c20-22(21,19-13-4-11-18-12-14-19)17-9-7-16(8-10-17)15-5-2-1-3-6-15/h1-3,5-10,18H,4,11-14H2 |
| InChIKey | MATIZRYLUFMJTK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |