C20H36N4O4S2 — CID 142646284
1-(4-methylphenyl)sulfonyl-5-methylsulfonyl-1,5,9,13-tetrazacyclohexadecane (PubChem CID 142646284) has the molecular formula C20H36N4O4S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5-methylsulfonyl-1,5,9,13-tetrazacyclohexadecane.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5-methylsulfonyl-1,5,9,13-tetrazacyclohexadecane |
|---|---|
| PubChem CID | 142646284 |
| Molecular Formula | C20H36N4O4S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5-methylsulfonyl-1,5,9,13-tetrazacyclohexadecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCNCCCNCCCN(S(C)(=O)=O)CCC2)cc1 |
| InChI | InChI=1S/C20H36N4O4S2/c1-19-7-9-20(10-8-19)30(27,28)24-16-5-14-22-12-3-11-21-13-4-15-23(17-6-18-24)29(2,25)26/h7-10,21-22H,3-6,11-18H2,1-2H3 |
| InChIKey | NOEQTBXCKPIELQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |