C28H35N3O4S2 — CID 11800633
3,11-bis-(4-methylphenyl)sulfonyl-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene (PubChem CID 11800633) has the molecular formula C28H35N3O4S2 and a molecular weight of 541.74 g/mol. Its IUPAC name is 3,11-bis-(4-methylphenyl)sulfonyl-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene.
| Compound Name | 3,11-bis-(4-methylphenyl)sulfonyl-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene |
|---|---|
| PubChem CID | 11800633 |
| Molecular Formula | C28H35N3O4S2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 3,11-bis-(4-methylphenyl)sulfonyl-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCNCCCN(S(=O)(=O)c3ccc(C)cc3)Cc3cccc(c3)C2)cc1 |
| InChI | InChI=1S/C28H35N3O4S2/c1-23-8-12-27(13-9-23)36(32,33)30-18-4-16-29-17-5-19-31(22-26-7-3-6-25(20-26)21-30)37(34,35)28-14-10-24(2)11-15-28/h3,6-15,20,29H,4-5,16-19,21-22H2,1-2H3 |
| InChIKey | TZOYXHOCYYGZMP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |