C21H25N5O2S — CID 135036195
1-benzyl-5-(4-methylphenyl)sulfonyl-4,6,7,8,9,10-hexahydrotriazolo[4,5-g][1,5]diazonine (PubChem CID 135036195) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-benzyl-5-(4-methylphenyl)sulfonyl-4,6,7,8,9,10-hexahydrotriazolo[4,5-g][1,5]diazonine.
| Compound Name | 1-benzyl-5-(4-methylphenyl)sulfonyl-4,6,7,8,9,10-hexahydrotriazolo[4,5-g][1,5]diazonine |
|---|---|
| PubChem CID | 135036195 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-benzyl-5-(4-methylphenyl)sulfonyl-4,6,7,8,9,10-hexahydrotriazolo[4,5-g][1,5]diazonine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCNCc3c(nnn3Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H25N5O2S/c1-17-8-10-19(11-9-17)29(27,28)25-13-5-12-22-14-21-20(16-25)23-24-26(21)15-18-6-3-2-4-7-18/h2-4,6-11,22H,5,12-16H2,1H3 |
| InChIKey | GYWWPSAYZALZHE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |