C30H38ClN3O4S2 — CID 127031827
1-(benzenesulfonyl)-9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride (PubChem CID 127031827) has the molecular formula C30H38ClN3O4S2 and a molecular weight of 604.24 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride.
| Compound Name | 1-(benzenesulfonyl)-9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride |
|---|---|
| PubChem CID | 127031827 |
| Molecular Formula | C30H38ClN3O4S2 |
| Molecular Weight | 604.24 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 1-(benzenesulfonyl)-9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride |
| SMILES | C=C1CN(S(=O)(=O)c2ccccc2)CCCN(Cc2ccccc2)CCCN(S(=O)(=O)c2ccc(C)cc2)C1.Cl |
| InChI | InChI=1S/C30H37N3O4S2.ClH/c1-26-15-17-30(18-16-26)39(36,37)33-22-10-20-31(25-28-11-5-3-6-12-28)19-9-21-32(23-27(2)24-33)38(34,35)29-13-7-4-8-14-29;/h3-8,11-18H,2,9-10,19-25H2,1H3;1H |
| InChIKey | YIHFYLABUZQAJD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|