C21H29N3O4S2 — CID 43816588
4-[(3-benzyl-1,3-diazinan-1-yl)sulfonyl]-N,N-diethylbenzenesulfonamide (PubChem CID 43816588) has the molecular formula C21H29N3O4S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is 4-[(3-benzyl-1,3-diazinan-1-yl)sulfonyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(3-benzyl-1,3-diazinan-1-yl)sulfonyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43816588 |
| Molecular Formula | C21H29N3O4S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-[(3-benzyl-1,3-diazinan-1-yl)sulfonyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2CCCN(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-3-23(4-2)29(25,26)20-11-13-21(14-12-20)30(27,28)24-16-8-15-22(18-24)17-19-9-6-5-7-10-19/h5-7,9-14H,3-4,8,15-18H2,1-2H3 |
| InChIKey | SVQRZLLWTBAYCP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |