C14H22N2O5S2 — CID 631492
N,N-diethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide (PubChem CID 631492) has the molecular formula C14H22N2O5S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N,N-diethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide.
| Compound Name | N,N-diethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 631492 |
| Molecular Formula | C14H22N2O5S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N,N-diethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H22N2O5S2/c1-3-15(4-2)22(17,18)13-5-7-14(8-6-13)23(19,20)16-9-11-21-12-10-16/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | GPJHIQXIBVLWRL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |