C18H22N2O5S2 — CID 646302
N,N-bis(but-2-ynyl)-4-morpholin-4-ylsulfonylbenzenesulfonamide (PubChem CID 646302) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N,N-bis(but-2-ynyl)-4-morpholin-4-ylsulfonylbenzenesulfonamide.
| Compound Name | N,N-bis(but-2-ynyl)-4-morpholin-4-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 646302 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N,N-bis(but-2-ynyl)-4-morpholin-4-ylsulfonylbenzenesulfonamide |
| SMILES | CC#CCN(CC#CC)S(=O)(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-3-5-11-19(12-6-4-2)26(21,22)17-7-9-18(10-8-17)27(23,24)20-13-15-25-16-14-20/h7-10H,11-16H2,1-2H3 |
| InChIKey | RLZXKJVIGXZTNV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|