C19H24N2O5S2 — CID 1167021
N-benzyl-N-ethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide (PubChem CID 1167021) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-benzyl-N-ethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide.
| Compound Name | N-benzyl-N-ethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 1167021 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-benzyl-N-ethyl-4-morpholin-4-ylsulfonylbenzenesulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H24N2O5S2/c1-2-20(16-17-6-4-3-5-7-17)27(22,23)18-8-10-19(11-9-18)28(24,25)21-12-14-26-15-13-21/h3-11H,2,12-16H2,1H3 |
| InChIKey | ROUKFNGOGKURGR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |