C23H26N2O4S2 — CID 1167043
1-N,4-N-dibenzyl-4-N-ethyl-1-N-methylbenzene-1,4-disulfonamide (PubChem CID 1167043) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-N,4-N-dibenzyl-4-N-ethyl-1-N-methylbenzene-1,4-disulfonamide.
| Compound Name | 1-N,4-N-dibenzyl-4-N-ethyl-1-N-methylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 1167043 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-N,4-N-dibenzyl-4-N-ethyl-1-N-methylbenzene-1,4-disulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(S(=O)(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-3-25(19-21-12-8-5-9-13-21)31(28,29)23-16-14-22(15-17-23)30(26,27)24(2)18-20-10-6-4-7-11-20/h4-17H,3,18-19H2,1-2H3 |
| InChIKey | KRPNRCLOIKJLDA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |