C22H30N2O4S2 — CID 3226867
N-benzyl-4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N-ethylbenzenesulfonamide (PubChem CID 3226867) has the molecular formula C22H30N2O4S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is N-benzyl-4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N-ethylbenzenesulfonamide.
| Compound Name | N-benzyl-4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3226867 |
| Molecular Formula | C22H30N2O4S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-benzyl-4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N-ethylbenzenesulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(S(=O)(=O)N2C(C)CCCC2C)cc1 |
| InChI | InChI=1S/C22H30N2O4S2/c1-4-23(17-20-11-6-5-7-12-20)29(25,26)21-13-15-22(16-14-21)30(27,28)24-18(2)9-8-10-19(24)3/h5-7,11-16,18-19H,4,8-10,17H2,1-3H3 |
| InChIKey | BRVWAJVUJNCOAL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |