C24H32N2O4S2 — CID 6551567
N-benzyl-N-cyclopentyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 6551567) has the molecular formula C24H32N2O4S2 and a molecular weight of 476.66 g/mol. Its IUPAC name is N-benzyl-N-cyclopentyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-benzyl-N-cyclopentyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 6551567 |
| Molecular Formula | C24H32N2O4S2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-benzyl-N-cyclopentyl-4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1ccc(S(=O)(=O)N(Cc2ccccc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C24H32N2O4S2/c1-20-9-7-8-18-25(20)31(27,28)23-14-16-24(17-15-23)32(29,30)26(22-12-5-6-13-22)19-21-10-3-2-4-11-21/h2-4,10-11,14-17,20,22H,5-9,12-13,18-19H2,1H3/t20-/m1/s1 |
| InChIKey | MCEIDWYSMAQGNA-HXUWFJFHSA-N |
| XLogP | 4.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |