C21H28N2O4S2 — CID 23909328
N-benzyl-4-(2-ethylpiperidin-1-yl)sulfonyl-N-methylbenzenesulfonamide (PubChem CID 23909328) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-benzyl-4-(2-ethylpiperidin-1-yl)sulfonyl-N-methylbenzenesulfonamide.
| Compound Name | N-benzyl-4-(2-ethylpiperidin-1-yl)sulfonyl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23909328 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-benzyl-4-(2-ethylpiperidin-1-yl)sulfonyl-N-methylbenzenesulfonamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(S(=O)(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O4S2/c1-3-19-11-7-8-16-23(19)29(26,27)21-14-12-20(13-15-21)28(24,25)22(2)17-18-9-5-4-6-10-18/h4-6,9-10,12-15,19H,3,7-8,11,16-17H2,1-2H3 |
| InChIKey | ZRRRENFWWQALFY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |