C20H26N2O4S2 — CID 1168554
N-benzyl-N-methyl-4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 1168554) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | N-benzyl-N-methyl-4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 1168554 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-benzyl-N-methyl-4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | C[C@H]1CCCCN1S(=O)(=O)c1ccc(S(=O)(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-17-8-6-7-15-22(17)28(25,26)20-13-11-19(12-14-20)27(23,24)21(2)16-18-9-4-3-5-10-18/h3-5,9-14,17H,6-8,15-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | SWIMCJSEZWOOAC-KRWDZBQOSA-N |
| XLogP | 3.07 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |