C25H33N3O5S2 — CID 3202258
2-[cyclopentyl-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]sulfonylamino]-N-phenylacetamide (PubChem CID 3202258) has the molecular formula C25H33N3O5S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[cyclopentyl-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]sulfonylamino]-N-phenylacetamide.
| Compound Name | 2-[cyclopentyl-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]sulfonylamino]-N-phenylacetamide |
|---|---|
| PubChem CID | 3202258 |
| Molecular Formula | C25H33N3O5S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 2-[cyclopentyl-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]sulfonylamino]-N-phenylacetamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C25H33N3O5S2/c1-20-9-7-8-18-27(20)34(30,31)23-14-16-24(17-15-23)35(32,33)28(22-12-5-6-13-22)19-25(29)26-21-10-3-2-4-11-21/h2-4,10-11,14-17,20,22H,5-9,12-13,18-19H2,1H3,(H,26,29) |
| InChIKey | IESVOILYQKMGQZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |