C13H19NO2S — CID 726586
(2R,6S)-1-(benzenesulfonyl)-2,6-dimethylpiperidine (PubChem CID 726586) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is (2R,6S)-1-(benzenesulfonyl)-2,6-dimethylpiperidine.
| Compound Name | (2R,6S)-1-(benzenesulfonyl)-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 726586 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2R,6S)-1-(benzenesulfonyl)-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2S/c1-11-7-6-8-12(2)14(11)17(15,16)13-9-4-3-5-10-13/h3-5,9-12H,6-8H2,1-2H3/t11-,12+ |
| InChIKey | JINDARNDFYFWDT-TXEJJXNPSA-N |
| XLogP | 2.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |