C14H18F3NO2S — CID 3253254
2,6-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 3253254) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2,6-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 2,6-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 3253254 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2,6-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO2S/c1-10-5-3-6-11(2)18(10)21(19,20)13-8-4-7-12(9-13)14(15,16)17/h4,7-11H,3,5-6H2,1-2H3 |
| InChIKey | OFAAQNBZBCYXBJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |