C17H19F3N2O4S — CID 4844120
1,8-dimethyl-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 4844120) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is 1,8-dimethyl-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,8-dimethyl-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 4844120 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1,8-dimethyl-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)C(=O)N(S(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)N2C |
| InChI | InChI=1S/C17H19F3N2O4S/c1-11-6-8-16(9-7-11)14(23)22(15(24)21(16)2)27(25,26)13-5-3-4-12(10-13)17(18,19)20/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | IIWQHCUMUOHOKE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|