C14H19F3N2O2S — CID 4986715
N-methyl-N-(1-methylpiperidin-4-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 4986715) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-methyl-N-(1-methylpiperidin-4-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-methyl-N-(1-methylpiperidin-4-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4986715 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-methyl-N-(1-methylpiperidin-4-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN1CCC(N(C)S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H19F3N2O2S/c1-18-8-6-12(7-9-18)19(2)22(20,21)13-5-3-4-11(10-13)14(15,16)17/h3-5,10,12H,6-9H2,1-2H3 |
| InChIKey | HYLWMZAAEKOOFD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |