C22H25F3N2O3S — CID 140641115
N-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 140641115) has the molecular formula C22H25F3N2O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 140641115 |
| Molecular Formula | C22H25F3N2O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN1CCC2(C)c3cc(O)ccc3C[C@@H]1[C@H]2N(C)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F3N2O3S/c1-21-9-10-26(2)19(11-14-7-8-16(28)13-18(14)21)20(21)27(3)31(29,30)17-6-4-5-15(12-17)22(23,24)25/h4-8,12-13,19-20,28H,9-11H2,1-3H3/t19-,20-,21?/m1/s1 |
| InChIKey | JARLUHHQIUJJJB-OSBQEZSISA-N |
| XLogP | 3.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |