C22H35N3O3S — CID 118507292
(1R,9R,13R)-1,10-dimethyl-13-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 118507292) has the molecular formula C22H35N3O3S and a molecular weight of 421.61 g/mol. Its IUPAC name is (1R,9R,13R)-1,10-dimethyl-13-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,13R)-1,10-dimethyl-13-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 118507292 |
| Molecular Formula | C22H35N3O3S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (1R,9R,13R)-1,10-dimethyl-13-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2N(C)CC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C22H35N3O3S/c1-22-9-12-23(2)20(13-17-5-6-18(26)14-19(17)22)21(22)24(3)15-16-7-10-25(11-8-16)29(4,27)28/h5-6,14,16,20-21,26H,7-13,15H2,1-4H3/t20-,21+,22-/m1/s1 |
| InChIKey | KRHFXJLGUDTNHW-BHIFYINESA-N |
| XLogP | 1.88 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |