C24H39N3O3S — CID 144958138
(1R,11R)-10-(dimethylamino)-1,9-dimethyl-11-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-4-ol (PubChem CID 144958138) has the molecular formula C24H39N3O3S and a molecular weight of 449.66 g/mol. Its IUPAC name is (1R,11R)-10-(dimethylamino)-1,9-dimethyl-11-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,11R)-10-(dimethylamino)-1,9-dimethyl-11-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 144958138 |
| Molecular Formula | C24H39N3O3S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (1R,11R)-10-(dimethylamino)-1,9-dimethyl-11-[methyl-[(1-methylsulfonylpiperidin-4-yl)methyl]amino]tricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-4-ol |
| SMILES | CN(C)C1[C@H](N(C)CC2CCN(S(C)(=O)=O)CC2)[C@]2(C)CC1(C)Cc1ccc(O)cc12 |
| InChI | InChI=1S/C24H39N3O3S/c1-23-14-18-7-8-19(28)13-20(18)24(2,16-23)22(21(23)25(3)4)26(5)15-17-9-11-27(12-10-17)31(6,29)30/h7-8,13,17,21-22,28H,9-12,14-16H2,1-6H3/t21?,22-,23?,24+/m0/s1 |
| InChIKey | UBYJSPLFXVIPNC-UEUFPXFLSA-N |
| XLogP | 2.52 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |