C16H23NO — CID 6602207
(1R,9S,14R)-1,11,14-trimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol (PubChem CID 6602207) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1R,9S,14R)-1,11,14-trimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9S,14R)-1,11,14-trimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 6602207 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1R,9S,14R)-1,11,14-trimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
| SMILES | C[C@@H]1[C@@H]2Cc3ccc(O)cc3[C@]1(C)CCN(C)C2 |
| InChI | InChI=1S/C16H23NO/c1-11-13-8-12-4-5-14(18)9-15(12)16(11,2)6-7-17(3)10-13/h4-5,9,11,13,18H,6-8,10H2,1-3H3/t11-,13-,16-/m1/s1 |
| InChIKey | WJIDGFVKDOMGDU-AXAPSJFSSA-N |
| XLogP | 2.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |