C16H23NO — CID 5493062
(1S,9R,14R)-1,10,14-trimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol (PubChem CID 5493062) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1S,9R,14R)-1,10,14-trimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,14R)-1,10,14-trimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 5493062 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1S,9R,14R)-1,10,14-trimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@@]1(C)CCCN2C |
| InChI | InChI=1S/C16H23NO/c1-11-15-9-12-5-6-13(18)10-14(12)16(11,2)7-4-8-17(15)3/h5-6,10-11,15,18H,4,7-9H2,1-3H3/t11-,15+,16-/m0/s1 |
| InChIKey | GNAYBRBMRQOCIM-XZJROXQQSA-N |
| XLogP | 2.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |