C20H30ClNO — CID 3040048
(1S,9S,14R)-1,14-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;hydrochloride (PubChem CID 3040048) has the molecular formula C20H30ClNO and a molecular weight of 335.92 g/mol. Its IUPAC name is (1S,9S,14R)-1,14-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;hydrochloride.
| Compound Name | (1S,9S,14R)-1,14-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;hydrochloride |
|---|---|
| PubChem CID | 3040048 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (1S,9S,14R)-1,14-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;hydrochloride |
| SMILES | CC(C)=CCN1CCC[C@]2(C)c3cc(O)ccc3C[C@H]1[C@@H]2C.Cl |
| InChI | InChI=1S/C20H29NO.ClH/c1-14(2)8-11-21-10-5-9-20(4)15(3)19(21)12-16-6-7-17(22)13-18(16)20;/h6-8,13,15,19,22H,5,9-12H2,1-4H3;1H/t15-,19-,20-;/m0./s1 |
| InChIKey | YPTHDRQPAVBRDN-ZAFWUOJLSA-N |
| XLogP | 4.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|