C27H38N2O — CID 144623410
(1S,9R,14S)-14-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol (PubChem CID 144623410) has the molecular formula C27H38N2O and a molecular weight of 406.61 g/mol. Its IUPAC name is (1S,9R,14S)-14-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,14S)-14-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 144623410 |
| Molecular Formula | C27H38N2O |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | (1S,9R,14S)-14-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol |
| SMILES | CN1CCC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2NCCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38N2O/c1-26(2,3)21-10-7-19(8-11-21)13-15-28-25-24-17-20-9-12-22(30)18-23(20)27(25,4)14-6-16-29(24)5/h7-12,18,24-25,28,30H,6,13-17H2,1-5H3/t24-,25-,27+/m1/s1 |
| InChIKey | NRBSBFWQAOLYKK-SLQPCKNISA-N |
| XLogP | 4.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |