C23H30N2O — CID 118507351
(1R,9R,13S)-1,10-dimethyl-13-(3-phenylpropylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 118507351) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (1R,9R,13S)-1,10-dimethyl-13-(3-phenylpropylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,13S)-1,10-dimethyl-13-(3-phenylpropylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 118507351 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (1R,9R,13S)-1,10-dimethyl-13-(3-phenylpropylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2NCCCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-23-12-14-25(2)21(15-18-10-11-19(26)16-20(18)23)22(23)24-13-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-11,16,21-22,24,26H,6,9,12-15H2,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | IPNFSOHLENCCDX-DNVJHFABSA-N |
| XLogP | 3.50 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|