C26H36N2O — CID 140641094
(9R,13S)-13-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 140641094) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is (9R,13S)-13-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (9R,13S)-13-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 140641094 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (9R,13S)-13-[2-(4-tert-butylphenyl)ethylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CN1CCC2(C)c3cc(O)ccc3C[C@@H]1[C@H]2NCCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H36N2O/c1-25(2,3)20-9-6-18(7-10-20)12-14-27-24-23-16-19-8-11-21(29)17-22(19)26(24,4)13-15-28(23)5/h6-11,17,23-24,27,29H,12-16H2,1-5H3/t23-,24-,26?/m1/s1 |
| InChIKey | QPFGHOAKKGUQTC-LBHOTPKDSA-N |
| XLogP | 4.41 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |