C23H30N2O3S — CID 126665188
(1S,9R,13S)-1,10-dimethyl-13-[2-(4-methylsulfonylphenyl)ethylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 126665188) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (1S,9R,13S)-1,10-dimethyl-13-[2-(4-methylsulfonylphenyl)ethylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,13S)-1,10-dimethyl-13-[2-(4-methylsulfonylphenyl)ethylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 126665188 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1S,9R,13S)-1,10-dimethyl-13-[2-(4-methylsulfonylphenyl)ethylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-23-11-13-25(2)21(14-17-6-7-18(26)15-20(17)23)22(23)24-12-10-16-4-8-19(9-5-16)29(3,27)28/h4-9,15,21-22,24,26H,10-14H2,1-3H3/t21-,22-,23+/m1/s1 |
| InChIKey | HSQYHGUXETZTTB-ZLNRFVROSA-N |
| XLogP | 2.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |