C18H28N2O — CID 126665191
(1S,9R,13S)-4-methoxy-1,10-dimethyl-N-propyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine (PubChem CID 126665191) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is (1S,9R,13S)-4-methoxy-1,10-dimethyl-N-propyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine.
| Compound Name | (1S,9R,13S)-4-methoxy-1,10-dimethyl-N-propyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine |
|---|---|
| PubChem CID | 126665191 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (1S,9R,13S)-4-methoxy-1,10-dimethyl-N-propyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine |
| SMILES | CCCN[C@@H]1[C@H]2Cc3ccc(OC)cc3[C@]1(C)CCN2C |
| InChI | InChI=1S/C18H28N2O/c1-5-9-19-17-16-11-13-6-7-14(21-4)12-15(13)18(17,2)8-10-20(16)3/h6-7,12,16-17,19H,5,8-11H2,1-4H3/t16-,17-,18+/m1/s1 |
| InChIKey | OMLAXWXNOSASMN-KURKYZTESA-N |
| XLogP | 2.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |