C18H26N2O — CID 118507252
(8R,9R,10R)-5-methoxy-8,11-dimethyl-N-propyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine (PubChem CID 118507252) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (8R,9R,10R)-5-methoxy-8,11-dimethyl-N-propyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine.
| Compound Name | (8R,9R,10R)-5-methoxy-8,11-dimethyl-N-propyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine |
|---|---|
| PubChem CID | 118507252 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (8R,9R,10R)-5-methoxy-8,11-dimethyl-N-propyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine |
| SMILES | CCCN[C@H]1[C@@H]2N(C)CC23C[C@]1(C)c1cc(OC)ccc13 |
| InChI | InChI=1S/C18H26N2O/c1-5-8-19-15-16-18(11-20(16)3)10-17(15,2)14-9-12(21-4)6-7-13(14)18/h6-7,9,15-16,19H,5,8,10-11H2,1-4H3/t15-,16-,17+,18?/m0/s1 |
| InChIKey | UMOCCJAKKSNSMJ-XNHLSEOASA-N |
| XLogP | 2.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |