C16H22N2O — CID 144958149
(8S,9S,10R)-5-methoxy-N,8,11-trimethyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine (PubChem CID 144958149) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (8S,9S,10R)-5-methoxy-N,8,11-trimethyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine.
| Compound Name | (8S,9S,10R)-5-methoxy-N,8,11-trimethyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine |
|---|---|
| PubChem CID | 144958149 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (8S,9S,10R)-5-methoxy-N,8,11-trimethyl-11-azatetracyclo[6.4.1.01,10.02,7]trideca-2(7),3,5-trien-9-amine |
| SMILES | CN[C@@H]1[C@@H]2N(C)CC23C[C@@]1(C)c1cc(OC)ccc13 |
| InChI | InChI=1S/C16H22N2O/c1-15-8-16(9-18(3)14(16)13(15)17-2)11-6-5-10(19-4)7-12(11)15/h5-7,13-14,17H,8-9H2,1-4H3/t13-,14+,15+,16?/m1/s1 |
| InChIKey | PHDJCTTYQHLHEM-WTPYQEHOSA-N |
| XLogP | 1.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |