C19H28N2O — CID 90122726
(1R,9R,13S)-10-(cyclopropylmethyl)-4-methoxy-N,1-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine (PubChem CID 90122726) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (1R,9R,13S)-10-(cyclopropylmethyl)-4-methoxy-N,1-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine.
| Compound Name | (1R,9R,13S)-10-(cyclopropylmethyl)-4-methoxy-N,1-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine |
|---|---|
| PubChem CID | 90122726 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (1R,9R,13S)-10-(cyclopropylmethyl)-4-methoxy-N,1-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine |
| SMILES | CN[C@@H]1[C@H]2Cc3ccc(OC)cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C19H28N2O/c1-19-8-9-21(12-13-4-5-13)17(18(19)20-2)10-14-6-7-15(22-3)11-16(14)19/h6-7,11,13,17-18,20H,4-5,8-10,12H2,1-3H3/t17-,18-,19-/m1/s1 |
| InChIKey | CGZIBAUWPCKMGA-GUDVDZBRSA-N |
| XLogP | 2.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |