C18H26N2 — CID 25087623
(1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine (PubChem CID 25087623) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 25087623 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-amine |
| SMILES | CC1[C@H]2Cc3ccc(N)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C18H26N2/c1-12-17-9-14-5-6-15(19)10-16(14)18(12,2)7-8-20(17)11-13-3-4-13/h5-6,10,12-13,17H,3-4,7-9,11,19H2,1-2H3/t12?,17-,18-/m1/s1 |
| InChIKey | STNPURITMRUHGJ-VIYFESSGSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|