C25H30N2O — CID 101334599
N-[(1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]benzamide (PubChem CID 101334599) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[(1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]benzamide.
| Compound Name | N-[(1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]benzamide |
|---|---|
| PubChem CID | 101334599 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[(1R,9R)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]benzamide |
| SMILES | CC1[C@H]2Cc3ccc(NC(=O)c4ccccc4)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C25H30N2O/c1-17-23-14-20-10-11-21(26-24(28)19-6-4-3-5-7-19)15-22(20)25(17,2)12-13-27(23)16-18-8-9-18/h3-7,10-11,15,17-18,23H,8-9,12-14,16H2,1-2H3,(H,26,28)/t17?,23-,25-/m1/s1 |
| InChIKey | VTQNVBWUUURPPT-MPBSXOEASA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |