C25H33NO2 — CID 149021389
[10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate (PubChem CID 149021389) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is [10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate.
| Compound Name | [10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 149021389 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | [10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate |
| SMILES | CC(C)=C/C=C/C(=O)Oc1ccc2c(c1)C1(C)CCN(CC3CC3)C(C2)C1C |
| InChI | InChI=1S/C25H33NO2/c1-17(2)6-5-7-24(27)28-21-11-10-20-14-23-18(3)25(4,22(20)15-21)12-13-26(23)16-19-8-9-19/h5-7,10-11,15,18-19,23H,8-9,12-14,16H2,1-4H3/b7-5+ |
| InChIKey | QDNNPEJHMKFKMZ-FNORWQNLSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|