C27H33NO3 — CID 146390037
[(1S,9R,15S)-10-(cyclobutylmethyl)-15-hydroxy-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate (PubChem CID 146390037) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is [(1S,9R,15S)-10-(cyclobutylmethyl)-15-hydroxy-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate.
| Compound Name | [(1S,9R,15S)-10-(cyclobutylmethyl)-15-hydroxy-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 146390037 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [(1S,9R,15S)-10-(cyclobutylmethyl)-15-hydroxy-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E)-5-methylhexa-2,4-dienoate |
| SMILES | CC(C)=C/C=C/C(=O)Oc1ccc2c(c1)[C@]13CCCC4(C1)N(CC1CCC1)[C@H](C2)[C@]43O |
| InChI | InChI=1S/C27H33NO3/c1-18(2)6-3-9-24(29)31-21-11-10-20-14-23-27(30)25(22(20)15-21)12-5-13-26(27,17-25)28(23)16-19-7-4-8-19/h3,6,9-11,15,19,23,30H,4-5,7-8,12-14,16-17H2,1-2H3/b9-3+/t23-,25+,26?,27-/m1/s1 |
| InChIKey | AKGMALYJQIKZQC-ZPUFOMGDSA-N |
| XLogP | 4.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|