C35H39NO3 — CID 44586890
[(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-phenylphenyl)acetate (PubChem CID 44586890) has the molecular formula C35H39NO3 and a molecular weight of 521.70 g/mol. Its IUPAC name is [(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-phenylphenyl)acetate.
| Compound Name | [(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 44586890 |
| Molecular Formula | C35H39NO3 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | [(1S,9R,10S)-17-(cyclobutylmethyl)-10-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 2-(4-phenylphenyl)acetate |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C35H39NO3/c37-33(21-25-11-13-28(14-12-25)27-9-2-1-3-10-27)39-30-16-15-29-22-32-35(38)18-5-4-17-34(35,31(29)23-30)19-20-36(32)24-26-7-6-8-26/h1-3,9-16,23,26,32,38H,4-8,17-22,24H2/t32-,34+,35-/m1/s1 |
| InChIKey | KXHUUIJDLZRBQX-VXMNRCMCSA-N |
| XLogP | 6.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|