C42H58N2O4 — CID 158543337
(1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol (PubChem CID 158543337) has the molecular formula C42H58N2O4 and a molecular weight of 654.94 g/mol. Its IUPAC name is (1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 158543337 |
| Molecular Formula | C42H58N2O4 |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.44 |
| IUPAC Name | (1S,9R,10S)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol |
| SMILES | Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3.Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/2C21H29NO2/c2*23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15/h2*6-7,13,15,19,23-24H,1-5,8-12,14H2/t2*19-,20+,21-/m11/s1 |
| InChIKey | HOULINCWPDZDQY-JGWWYFPVSA-N |
| XLogP | 6.73 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |