C24H33N5O2 — CID 167423574
(1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(triazol-2-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol (PubChem CID 167423574) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(triazol-2-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol.
| Compound Name | (1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(triazol-2-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
|---|---|
| PubChem CID | 167423574 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (1S,9R,10S)-18-(cyclopropylmethyl)-13-[2-(triazol-2-yl)ethyl]-13,18-diazatetracyclo[7.6.3.01,10.02,7]octadeca-2(7),3,5-triene-4,10-diol |
| SMILES | Oc1ccc2c(c1)[C@@]13CCN(CCn4nccn4)CC[C@@]1(O)[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C24H33N5O2/c30-20-4-3-19-15-22-24(31)7-11-27(13-14-29-25-8-9-26-29)10-5-23(24,21(19)16-20)6-12-28(22)17-18-1-2-18/h3-4,8-9,16,18,22,30-31H,1-2,5-7,10-15,17H2/t22-,23+,24-/m1/s1 |
| InChIKey | HMGRIIHPFQUGJD-TZRRMPRUSA-N |
| XLogP | 1.79 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |